C14H30O5Si — CID 72945079
methyl (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5-methoxyhexanoate (PubChem CID 72945079) has the molecular formula C14H30O5Si and a molecular weight of 306.48 g/mol. Its IUPAC name is methyl (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5-methoxyhexanoate.
| Compound Name | methyl (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5-methoxyhexanoate |
|---|---|
| PubChem CID | 72945079 |
| Molecular Formula | C14H30O5Si |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | methyl (3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5-methoxyhexanoate |
| SMILES | COC(=O)C[C@H](C[C@H](CO)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O5Si/c1-14(2,3)20(6,7)19-11(9-13(16)18-5)8-12(10-15)17-4/h11-12,15H,8-10H2,1-7H3/t11-,12+/m0/s1 |
| InChIKey | UQVDVBAEDFXJKD-NWDGAFQWSA-N |
| XLogP | 2.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|