C19H40O6Si2 — CID 14483580
methyl (2R,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolane-2-carboxylate (PubChem CID 14483580) has the molecular formula C19H40O6Si2 and a molecular weight of 420.70 g/mol. Its IUPAC name is methyl (2R,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolane-2-carboxylate.
| Compound Name | methyl (2R,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 14483580 |
| Molecular Formula | C19H40O6Si2 |
| Molecular Weight | 420.70 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | methyl (2R,3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(hydroxymethyl)oxolane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O6Si2/c1-18(2,3)26(8,9)24-14-13(12-20)23-16(17(21)22-7)15(14)25-27(10,11)19(4,5)6/h13-16,20H,12H2,1-11H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | KAQJNSSMYNCBSF-KLHDSHLOSA-N |
| XLogP | 3.70 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.70 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|