C18H40O7Si4 — CID 553475
trimethylsilyl 2-[5-oxo-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetate (PubChem CID 553475) has the molecular formula C18H40O7Si4 and a molecular weight of 480.86 g/mol. Its IUPAC name is trimethylsilyl 2-[5-oxo-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetate.
| Compound Name | trimethylsilyl 2-[5-oxo-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetate |
|---|---|
| PubChem CID | 553475 |
| Molecular Formula | C18H40O7Si4 |
| Molecular Weight | 480.86 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | trimethylsilyl 2-[5-oxo-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetate |
| SMILES | C[Si](C)(C)OC(=O)C(O[Si](C)(C)C)C1OC(=O)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C18H40O7Si4/c1-26(2,3)22-14-13(21-17(19)16(14)24-28(7,8)9)15(23-27(4,5)6)18(20)25-29(10,11)12/h13-16H,1-12H3 |
| InChIKey | ZEVFIEFYBHUBDV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|