C15H33FO5Si3 — CID 147712641
(3R,4R,5R,6R)-5-fluoro-3,4-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one (PubChem CID 147712641) has the molecular formula C15H33FO5Si3 and a molecular weight of 396.68 g/mol. Its IUPAC name is (3R,4R,5R,6R)-5-fluoro-3,4-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one.
| Compound Name | (3R,4R,5R,6R)-5-fluoro-3,4-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 147712641 |
| Molecular Formula | C15H33FO5Si3 |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (3R,4R,5R,6R)-5-fluoro-3,4-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one |
| SMILES | C[Si](C)(C)OC[C@H]1OC(=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1F |
| InChI | InChI=1S/C15H33FO5Si3/c1-22(2,3)18-10-11-12(16)13(20-23(4,5)6)14(15(17)19-11)21-24(7,8)9/h11-14H,10H2,1-9H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | GUZZYVWORNUHFF-YIYPIFLZSA-N |
| XLogP | 3.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|