C14H32O5Si3 — CID 523413
3,4,5-tris(trimethylsilyloxy)oxan-2-one (PubChem CID 523413) has the molecular formula C14H32O5Si3 and a molecular weight of 364.66 g/mol. Its IUPAC name is 3,4,5-tris(trimethylsilyloxy)oxan-2-one.
| Compound Name | 3,4,5-tris(trimethylsilyloxy)oxan-2-one |
|---|---|
| PubChem CID | 523413 |
| Molecular Formula | C14H32O5Si3 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 3,4,5-tris(trimethylsilyloxy)oxan-2-one |
| SMILES | C[Si](C)(C)OC1COC(=O)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C14H32O5Si3/c1-20(2,3)17-11-10-16-14(15)13(19-22(7,8)9)12(11)18-21(4,5)6/h11-13H,10H2,1-9H3 |
| InChIKey | RWGTVHCZLUFFAU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|