C15H34O6Si3 — CID 553028
1-O-ethyl 4-O-trimethylsilyl 2,3-bis(trimethylsilyloxy)butanedioate (PubChem CID 553028) has the molecular formula C15H34O6Si3 and a molecular weight of 394.69 g/mol. Its IUPAC name is 1-O-ethyl 4-O-trimethylsilyl 2,3-bis(trimethylsilyloxy)butanedioate.
| Compound Name | 1-O-ethyl 4-O-trimethylsilyl 2,3-bis(trimethylsilyloxy)butanedioate |
|---|---|
| PubChem CID | 553028 |
| Molecular Formula | C15H34O6Si3 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-O-ethyl 4-O-trimethylsilyl 2,3-bis(trimethylsilyloxy)butanedioate |
| SMILES | CCOC(=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C15H34O6Si3/c1-11-18-14(16)12(19-22(2,3)4)13(20-23(5,6)7)15(17)21-24(8,9)10/h12-13H,11H2,1-10H3 |
| InChIKey | SXWHBLVYVDZRDL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|