C18H38O6Si2 — CID 15098268
dimethyl (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butanedioate (PubChem CID 15098268) has the molecular formula C18H38O6Si2 and a molecular weight of 406.67 g/mol. Its IUPAC name is dimethyl (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butanedioate.
| Compound Name | dimethyl (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butanedioate |
|---|---|
| PubChem CID | 15098268 |
| Molecular Formula | C18H38O6Si2 |
| Molecular Weight | 406.67 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | dimethyl (2R,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butanedioate |
| SMILES | COC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C18H38O6Si2/c1-17(2,3)25(9,10)23-13(15(19)21-7)14(16(20)22-8)24-26(11,12)18(4,5)6/h13-14H,1-12H3/t13-,14-/m1/s1 |
| InChIKey | UXUMTMVSWMDPQE-ZIAGYGMSSA-N |
| XLogP | 4.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|