C16H40O5Si4 — CID 528672
trimethylsilyl 2,3,4-tris(trimethylsilyloxy)butanoate (PubChem CID 528672) has the molecular formula C16H40O5Si4 and a molecular weight of 424.84 g/mol. Its IUPAC name is trimethylsilyl 2,3,4-tris(trimethylsilyloxy)butanoate.
| Compound Name | trimethylsilyl 2,3,4-tris(trimethylsilyloxy)butanoate |
|---|---|
| PubChem CID | 528672 |
| Molecular Formula | C16H40O5Si4 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | trimethylsilyl 2,3,4-tris(trimethylsilyloxy)butanoate |
| SMILES | C[Si](C)(C)OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H40O5Si4/c1-22(2,3)18-13-14(19-23(4,5)6)15(20-24(7,8)9)16(17)21-25(10,11)12/h14-15H,13H2,1-12H3 |
| InChIKey | IEXXQBIANMZJJP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|