C22H48O5Si3 — CID 528581
bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxybutanedioate (PubChem CID 528581) has the molecular formula C22H48O5Si3 and a molecular weight of 476.88 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxybutanedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxybutanedioate |
|---|---|
| PubChem CID | 528581 |
| Molecular Formula | C22H48O5Si3 |
| Molecular Weight | 476.88 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 2-[tert-butyl(dimethyl)silyl]oxybutanedioate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)CC(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H48O5Si3/c1-20(2,3)28(10,11)25-17(19(24)27-30(14,15)22(7,8)9)16-18(23)26-29(12,13)21(4,5)6/h17H,16H2,1-15H3 |
| InChIKey | LGKDLSNIOMYKSN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.88 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|