C22H46O6Si2 — CID 11762344
dipropan-2-yl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butanedioate (PubChem CID 11762344) has the molecular formula C22H46O6Si2 and a molecular weight of 462.78 g/mol. Its IUPAC name is dipropan-2-yl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butanedioate.
| Compound Name | dipropan-2-yl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butanedioate |
|---|---|
| PubChem CID | 11762344 |
| Molecular Formula | C22H46O6Si2 |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | dipropan-2-yl (2S,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]butanedioate |
| SMILES | CC(C)OC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C22H46O6Si2/c1-15(2)25-19(23)17(27-29(11,12)21(5,6)7)18(20(24)26-16(3)4)28-30(13,14)22(8,9)10/h15-18H,1-14H3/t17-,18-/m0/s1 |
| InChIKey | PSVMQGIDWRZGOZ-ROUUACIJSA-N |
| XLogP | 5.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|