C10H22O4Si2 — CID 523398
3,4-bis(trimethylsilyloxy)oxolan-2-one (PubChem CID 523398) has the molecular formula C10H22O4Si2 and a molecular weight of 262.45 g/mol. Its IUPAC name is 3,4-bis(trimethylsilyloxy)oxolan-2-one.
| Compound Name | 3,4-bis(trimethylsilyloxy)oxolan-2-one |
|---|---|
| PubChem CID | 523398 |
| Molecular Formula | C10H22O4Si2 |
| Molecular Weight | 262.45 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 3,4-bis(trimethylsilyloxy)oxolan-2-one |
| SMILES | C[Si](C)(C)OC1COC(=O)C1O[Si](C)(C)C |
| InChI | InChI=1S/C10H22O4Si2/c1-15(2,3)13-8-7-12-10(11)9(8)14-16(4,5)6/h8-9H,7H2,1-6H3 |
| InChIKey | ASNCBNVBJKSVIT-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|