C11H22O5Si — CID 91701873
methyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-trimethylsilyloxyacetate (PubChem CID 91701873) has the molecular formula C11H22O5Si and a molecular weight of 262.38 g/mol. Its IUPAC name is methyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-trimethylsilyloxyacetate.
| Compound Name | methyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-trimethylsilyloxyacetate |
|---|---|
| PubChem CID | 91701873 |
| Molecular Formula | C11H22O5Si |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl 2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-trimethylsilyloxyacetate |
| SMILES | COC(=O)C(O[Si](C)(C)C)C1COC(C)(C)O1 |
| InChI | InChI=1S/C11H22O5Si/c1-11(2)14-7-8(15-11)9(10(12)13-3)16-17(4,5)6/h8-9H,7H2,1-6H3 |
| InChIKey | ZZLDEXWJQNDGQG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|