C24H50O10Si2 — CID 14737948
diethyl (2S,3S,4S,5S,6S,7S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3,6,7-tetrahydroxyoctanedioate (PubChem CID 14737948) has the molecular formula C24H50O10Si2 and a molecular weight of 554.83 g/mol. Its IUPAC name is diethyl (2S,3S,4S,5S,6S,7S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3,6,7-tetrahydroxyoctanedioate.
| Compound Name | diethyl (2S,3S,4S,5S,6S,7S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3,6,7-tetrahydroxyoctanedioate |
|---|---|
| PubChem CID | 14737948 |
| Molecular Formula | C24H50O10Si2 |
| Molecular Weight | 554.83 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | diethyl (2S,3S,4S,5S,6S,7S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2,3,6,7-tetrahydroxyoctanedioate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)C(=O)OCC |
| InChI | InChI=1S/C24H50O10Si2/c1-13-31-21(29)17(27)15(25)19(33-35(9,10)23(3,4)5)20(34-36(11,12)24(6,7)8)16(26)18(28)22(30)32-14-2/h15-20,25-28H,13-14H2,1-12H3/t15-,16-,17-,18-,19-,20-/m0/s1 |
| InChIKey | OOKSRMFSEKOEPF-RABCQHRBSA-N |
| XLogP | 2.34 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.83 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|