C30H60O8Si2 — CID 134990997
propan-2-yl (2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4S,6R)-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]propanoate (PubChem CID 134990997) has the molecular formula C30H60O8Si2 and a molecular weight of 604.97 g/mol. Its IUPAC name is propan-2-yl (2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4S,6R)-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]propanoate.
| Compound Name | propan-2-yl (2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4S,6R)-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]propanoate |
|---|---|
| PubChem CID | 134990997 |
| Molecular Formula | C30H60O8Si2 |
| Molecular Weight | 604.97 g/mol |
| Exact Mass | 604.38 |
| IUPAC Name | propan-2-yl (2S,3R)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-[(4S,6R)-2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]propanoate |
| SMILES | CC(C)OC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C30H60O8Si2/c1-20(2)33-26(32)25(38-40(16,17)29(9,10)11)24(37-39(14,15)28(6,7)8)22-18-21(34-30(12,13)35-22)19-23(31)36-27(3,4)5/h20-22,24-25H,18-19H2,1-17H3/t21-,22+,24-,25+/m1/s1 |
| InChIKey | MBMJMMJTCCYQTK-OUMDNPPYSA-N |
| XLogP | 7.36 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.97 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|