C20H40O5Si2 — CID 138983144
(3R,4R)-3,4-bis(triethylsilyloxy)-1,10-dioxaspiro[4.5]decan-2-one (PubChem CID 138983144) has the molecular formula C20H40O5Si2 and a molecular weight of 416.71 g/mol. Its IUPAC name is (3R,4R)-3,4-bis(triethylsilyloxy)-1,10-dioxaspiro[4.5]decan-2-one.
| Compound Name | (3R,4R)-3,4-bis(triethylsilyloxy)-1,10-dioxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 138983144 |
| Molecular Formula | C20H40O5Si2 |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | (3R,4R)-3,4-bis(triethylsilyloxy)-1,10-dioxaspiro[4.5]decan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](O[Si](CC)(CC)CC)C(=O)OC12CCCCO2 |
| InChI | InChI=1S/C20H40O5Si2/c1-7-26(8-2,9-3)24-17-18(25-27(10-4,11-5)12-6)20(23-19(17)21)15-13-14-16-22-20/h17-18H,7-16H2,1-6H3/t17-,18-,20?/m1/s1 |
| InChIKey | ZFEWBGNCYZZTCS-KUBVQFIISA-N |
| XLogP | 5.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|