C22H52O7Si5 — CID 553476
3,4-bis(trimethylsilyloxy)-5-[1,2,3-tris(trimethylsilyloxy)propyl]oxolan-2-one (PubChem CID 553476) has the molecular formula C22H52O7Si5 and a molecular weight of 569.08 g/mol. Its IUPAC name is 3,4-bis(trimethylsilyloxy)-5-[1,2,3-tris(trimethylsilyloxy)propyl]oxolan-2-one.
| Compound Name | 3,4-bis(trimethylsilyloxy)-5-[1,2,3-tris(trimethylsilyloxy)propyl]oxolan-2-one |
|---|---|
| PubChem CID | 553476 |
| Molecular Formula | C22H52O7Si5 |
| Molecular Weight | 569.08 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 3,4-bis(trimethylsilyloxy)-5-[1,2,3-tris(trimethylsilyloxy)propyl]oxolan-2-one |
| SMILES | C[Si](C)(C)OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC(=O)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C22H52O7Si5/c1-30(2,3)24-16-17(26-31(4,5)6)18(27-32(7,8)9)19-20(28-33(10,11)12)21(22(23)25-19)29-34(13,14)15/h17-21H,16H2,1-15H3 |
| InChIKey | PSGHGDZCHPRHRA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.08 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|