C15H32O6Si3 — CID 553539
2-[5-oxo-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetaldehyde (PubChem CID 553539) has the molecular formula C15H32O6Si3 and a molecular weight of 392.67 g/mol. Its IUPAC name is 2-[5-oxo-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetaldehyde.
| Compound Name | 2-[5-oxo-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetaldehyde |
|---|---|
| PubChem CID | 553539 |
| Molecular Formula | C15H32O6Si3 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-[5-oxo-3,4-bis(trimethylsilyloxy)oxolan-2-yl]-2-trimethylsilyloxyacetaldehyde |
| SMILES | C[Si](C)(C)OC(C=O)C1OC(=O)C(O[Si](C)(C)C)C1O[Si](C)(C)C |
| InChI | InChI=1S/C15H32O6Si3/c1-22(2,3)19-11(10-16)12-13(20-23(4,5)6)14(15(17)18-12)21-24(7,8)9/h10-14H,1-9H3 |
| InChIKey | NGXKKSIAXZQKDH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|