C22H44O7Si2 — CID 11113551
methyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-2-oxobutanoate (PubChem CID 11113551) has the molecular formula C22H44O7Si2 and a molecular weight of 476.76 g/mol. Its IUPAC name is methyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-2-oxobutanoate.
| Compound Name | methyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-2-oxobutanoate |
|---|---|
| PubChem CID | 11113551 |
| Molecular Formula | C22H44O7Si2 |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | methyl (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]-2-oxobutanoate |
| SMILES | COC(=O)C(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H](C)OC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O7Si2/c1-15-26-14-18(29-31(11,12)22(5,6)7)19(27-15)17(13-16(23)20(24)25-8)28-30(9,10)21(2,3)4/h15,17-19H,13-14H2,1-12H3/t15-,17+,18-,19+/m1/s1 |
| InChIKey | KAIORUROAWGWRP-LULLPPNCSA-N |
| XLogP | 4.66 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|