C20H36O8Si — CID 134832224
methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate (PubChem CID 134832224) has the molecular formula C20H36O8Si and a molecular weight of 432.59 g/mol. Its IUPAC name is methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate.
| Compound Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate |
|---|---|
| PubChem CID | 134832224 |
| Molecular Formula | C20H36O8Si |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | methyl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1S,2R,6R,8S,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]acetate |
| SMILES | COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C20H36O8Si/c1-18(2,3)29(9,10)28-14(16(21)22-8)11-12-13(25-19(4,5)24-12)15-17(23-11)27-20(6,7)26-15/h11-15,17H,1-10H3/t11-,12-,13-,14-,15+,17+/m0/s1 |
| InChIKey | WRBXHRVJMCPCFT-PTCFPADLSA-N |
| XLogP | 2.95 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|