C18H32O7Si — CID 91697282
[tert-butyl(dimethyl)silyl] 4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate (PubChem CID 91697282) has the molecular formula C18H32O7Si and a molecular weight of 388.53 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] 4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate.
| Compound Name | [tert-butyl(dimethyl)silyl] 4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate |
|---|---|
| PubChem CID | 91697282 |
| Molecular Formula | C18H32O7Si |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] 4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxylate |
| SMILES | CC1(C)OC2OC(C(=O)O[Si](C)(C)C(C)(C)C)C3OC(C)(C)OC3C2O1 |
| InChI | InChI=1S/C18H32O7Si/c1-16(2,3)26(8,9)25-14(19)12-10-11(22-17(4,5)21-10)13-15(20-12)24-18(6,7)23-13/h10-13,15H,1-9H3 |
| InChIKey | SEMSTHMQNKPVEX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|