C21H50O7Si5 — CID 91747578
trimethylsilyl (3R,6R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxane-2-carboxylate (PubChem CID 91747578) has the molecular formula C21H50O7Si5 and a molecular weight of 555.05 g/mol. Its IUPAC name is trimethylsilyl (3R,6R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxane-2-carboxylate.
| Compound Name | trimethylsilyl (3R,6R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 91747578 |
| Molecular Formula | C21H50O7Si5 |
| Molecular Weight | 555.05 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | trimethylsilyl (3R,6R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxane-2-carboxylate |
| SMILES | C[Si](C)(C)OC(=O)C1O[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C21H50O7Si5/c1-29(2,3)24-16-17(25-30(4,5)6)19(26-31(7,8)9)21(28-33(13,14)15)23-18(16)20(22)27-32(10,11)12/h16-19,21H,1-15H3/t16-,17?,18?,19?,21+/m0/s1 |
| InChIKey | ZJKACRRFXMWHBG-MKUWGOOTSA-N |
| XLogP | 5.60 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.05 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|