C15H32O6Si3 — CID 553537
2,3,6-tris(trimethylsilyloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one (PubChem CID 553537) has the molecular formula C15H32O6Si3 and a molecular weight of 392.67 g/mol. Its IUPAC name is 2,3,6-tris(trimethylsilyloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | 2,3,6-tris(trimethylsilyloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 553537 |
| Molecular Formula | C15H32O6Si3 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2,3,6-tris(trimethylsilyloxy)-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-5-one |
| SMILES | C[Si](C)(C)OC1OC2C(O[Si](C)(C)C)C(=O)OC2C1O[Si](C)(C)C |
| InChI | InChI=1S/C15H32O6Si3/c1-22(2,3)19-12-10-11(17-14(12)16)13(20-23(4,5)6)15(18-10)21-24(7,8)9/h10-13,15H,1-9H3 |
| InChIKey | XYVSGYLYEFHXSB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|