C23H38O12Si — CID 135015988
methyl (2S)-2-[(3S)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetate (PubChem CID 135015988) has the molecular formula C23H38O12Si and a molecular weight of 534.63 g/mol. Its IUPAC name is methyl (2S)-2-[(3S)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetate.
| Compound Name | methyl (2S)-2-[(3S)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetate |
|---|---|
| PubChem CID | 135015988 |
| Molecular Formula | C23H38O12Si |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | methyl (2S)-2-[(3S)-3,3a,4-triacetyloxy-7-methoxy-2,3,4,5,7,7a-hexahydrofuro[2,3-c]pyran-5-yl]-2-[tert-butyl(dimethyl)silyl]oxyacetate |
| SMILES | COC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)C1OC(OC)C2OC[C@H](OC(C)=O)C2(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C23H38O12Si/c1-12(24)31-15-11-30-19-21(29-8)33-16(18(32-13(2)25)23(15,19)34-14(3)26)17(20(27)28-7)35-36(9,10)22(4,5)6/h15-19,21H,11H2,1-10H3/t15-,16?,17-,18?,19?,21?,23?/m0/s1 |
| InChIKey | HGVYAHYBELARRF-VOAFXLRUSA-N |
| XLogP | 1.49 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|