C19H36O7Si — CID 155932018
dimethyl (4R,5R)-2,2-dimethyl-4-(3-triethylsilyloxybutyl)-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 155932018) has the molecular formula C19H36O7Si and a molecular weight of 404.58 g/mol. Its IUPAC name is dimethyl (4R,5R)-2,2-dimethyl-4-(3-triethylsilyloxybutyl)-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dimethyl (4R,5R)-2,2-dimethyl-4-(3-triethylsilyloxybutyl)-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 155932018 |
| Molecular Formula | C19H36O7Si |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | dimethyl (4R,5R)-2,2-dimethyl-4-(3-triethylsilyloxybutyl)-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CC[Si](CC)(CC)OC(C)CC[C@@]1(C(=O)OC)OC(C)(C)O[C@H]1C(=O)OC |
| InChI | InChI=1S/C19H36O7Si/c1-9-27(10-2,11-3)25-14(4)12-13-19(17(21)23-8)15(16(20)22-7)24-18(5,6)26-19/h14-15H,9-13H2,1-8H3/t14?,15-,19+/m0/s1 |
| InChIKey | QFEJVOGKXSWRGA-DZNRSUDRSA-N |
| XLogP | 3.41 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|