C29H60O7Si3 — CID 23631142
methyl 2-[(2S,3R,4R,5S,6S)-2-acetyl-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]acetate (PubChem CID 23631142) has the molecular formula C29H60O7Si3 and a molecular weight of 605.05 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4R,5S,6S)-2-acetyl-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,4R,5S,6S)-2-acetyl-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]acetate |
|---|---|
| PubChem CID | 23631142 |
| Molecular Formula | C29H60O7Si3 |
| Molecular Weight | 605.05 g/mol |
| Exact Mass | 604.36 |
| IUPAC Name | methyl 2-[(2S,3R,4R,5S,6S)-2-acetyl-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-6-methyloxan-2-yl]acetate |
| SMILES | COC(=O)C[C@]1(C(C)=O)O[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H60O7Si3/c1-20-23(34-37(13,14)26(3,4)5)24(35-38(15,16)27(6,7)8)25(36-39(17,18)28(9,10)11)29(33-20,21(2)30)19-22(31)32-12/h20,23-25H,19H2,1-18H3/t20-,23-,24+,25+,29+/m0/s1 |
| InChIKey | BNWYHBVGLMBFRH-PIZXFEGRSA-N |
| XLogP | 7.47 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.05 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|