C24H40O8Si — CID 59917220
[4-acetyl-2-[[ethyl-di(propan-2-yl)silyl]oxymethyl]-6-methyl-5-(4-methyl-2,5-dioxooxolan-3-yl)oxan-3-yl] acetate (PubChem CID 59917220) has the molecular formula C24H40O8Si and a molecular weight of 484.66 g/mol. Its IUPAC name is [4-acetyl-2-[[ethyl-di(propan-2-yl)silyl]oxymethyl]-6-methyl-5-(4-methyl-2,5-dioxooxolan-3-yl)oxan-3-yl] acetate.
| Compound Name | [4-acetyl-2-[[ethyl-di(propan-2-yl)silyl]oxymethyl]-6-methyl-5-(4-methyl-2,5-dioxooxolan-3-yl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 59917220 |
| Molecular Formula | C24H40O8Si |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | [4-acetyl-2-[[ethyl-di(propan-2-yl)silyl]oxymethyl]-6-methyl-5-(4-methyl-2,5-dioxooxolan-3-yl)oxan-3-yl] acetate |
| SMILES | CC[Si](OCC1OC(C)C(C2C(=O)OC(=O)C2C)C(C(C)=O)C1OC(C)=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C24H40O8Si/c1-10-33(12(2)3,13(4)5)29-11-18-22(31-17(9)26)20(15(7)25)21(16(8)30-18)19-14(6)23(27)32-24(19)28/h12-14,16,18-22H,10-11H2,1-9H3 |
| InChIKey | BMPNMFBKXGIJEK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|