C30H52O11Si2 — CID 20822633
5-O-tert-butyl 1-O-methyl 4-[[2,5-dioxo-4-[2-[2-(2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carbonyl)oxyethoxy]propyl]oxolan-3-yl]methyl]-2,2-dimethylpentanedioate (PubChem CID 20822633) has the molecular formula C30H52O11Si2 and a molecular weight of 644.91 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-methyl 4-[[2,5-dioxo-4-[2-[2-(2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carbonyl)oxyethoxy]propyl]oxolan-3-yl]methyl]-2,2-dimethylpentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-methyl 4-[[2,5-dioxo-4-[2-[2-(2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carbonyl)oxyethoxy]propyl]oxolan-3-yl]methyl]-2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 20822633 |
| Molecular Formula | C30H52O11Si2 |
| Molecular Weight | 644.91 g/mol |
| Exact Mass | 644.30 |
| IUPAC Name | 5-O-tert-butyl 1-O-methyl 4-[[2,5-dioxo-4-[2-[2-(2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carbonyl)oxyethoxy]propyl]oxolan-3-yl]methyl]-2,2-dimethylpentanedioate |
| SMILES | COC(=O)C(C)(C)CC(CC1C(=O)OC(=O)C1CC(C)OCCOC(=O)C1C[Si](C)(C)O[Si](C)(C)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H52O11Si2/c1-19(37-12-13-38-24(31)21-17-42(8,9)41-43(10,11)18-21)14-22-23(27(34)39-26(22)33)15-20(25(32)40-29(2,3)4)16-30(5,6)28(35)36-7/h19-23H,12-18H2,1-11H3 |
| InChIKey | BAGNBPAZBXUZJV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.91 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|