C25H46O8Si — CID 20580298
2-methoxyethyl 4-[[2,5-dioxo-4-(1-trimethylsilylbutan-2-yl)oxolan-3-yl]methyl]-5-hydroperoxy-2,6,6-trimethylheptanoate (PubChem CID 20580298) has the molecular formula C25H46O8Si and a molecular weight of 502.72 g/mol. Its IUPAC name is 2-methoxyethyl 4-[[2,5-dioxo-4-(1-trimethylsilylbutan-2-yl)oxolan-3-yl]methyl]-5-hydroperoxy-2,6,6-trimethylheptanoate.
| Compound Name | 2-methoxyethyl 4-[[2,5-dioxo-4-(1-trimethylsilylbutan-2-yl)oxolan-3-yl]methyl]-5-hydroperoxy-2,6,6-trimethylheptanoate |
|---|---|
| PubChem CID | 20580298 |
| Molecular Formula | C25H46O8Si |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 2-methoxyethyl 4-[[2,5-dioxo-4-(1-trimethylsilylbutan-2-yl)oxolan-3-yl]methyl]-5-hydroperoxy-2,6,6-trimethylheptanoate |
| SMILES | CCC(C[Si](C)(C)C)C1C(=O)OC(=O)C1CC(CC(C)C(=O)OCCOC)C(OO)C(C)(C)C |
| InChI | InChI=1S/C25H46O8Si/c1-10-17(15-34(7,8)9)20-19(23(27)32-24(20)28)14-18(21(33-29)25(3,4)5)13-16(2)22(26)31-12-11-30-6/h16-21,29H,10-15H2,1-9H3 |
| InChIKey | BNOHYBDXQRBKNE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|