C28H52O6Si2 — CID 59897759
[3,3,4-trimethyl-2,4-bis(trimethylsilyl)pentan-2-yl] 2-methyl-2-[4-(2-methyloxolan-3-yl)-2,5-dioxooxolan-3-yl]butanoate (PubChem CID 59897759) has the molecular formula C28H52O6Si2 and a molecular weight of 540.89 g/mol. Its IUPAC name is [3,3,4-trimethyl-2,4-bis(trimethylsilyl)pentan-2-yl] 2-methyl-2-[4-(2-methyloxolan-3-yl)-2,5-dioxooxolan-3-yl]butanoate.
| Compound Name | [3,3,4-trimethyl-2,4-bis(trimethylsilyl)pentan-2-yl] 2-methyl-2-[4-(2-methyloxolan-3-yl)-2,5-dioxooxolan-3-yl]butanoate |
|---|---|
| PubChem CID | 59897759 |
| Molecular Formula | C28H52O6Si2 |
| Molecular Weight | 540.89 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | [3,3,4-trimethyl-2,4-bis(trimethylsilyl)pentan-2-yl] 2-methyl-2-[4-(2-methyloxolan-3-yl)-2,5-dioxooxolan-3-yl]butanoate |
| SMILES | CCC(C)(C(=O)OC(C)(C(C)(C)C(C)(C)[Si](C)(C)C)[Si](C)(C)C)C1C(=O)OC(=O)C1C1CCOC1C |
| InChI | InChI=1S/C28H52O6Si2/c1-15-27(7,21-20(22(29)33-23(21)30)19-16-17-32-18(19)2)24(31)34-28(8,36(12,13)14)25(3,4)26(5,6)35(9,10)11/h18-21H,15-17H2,1-14H3 |
| InChIKey | JAXHYEJHNBEFCF-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.89 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|