C23H44O5Si — CID 20580310
3-[2-(1-hydroperoxy-2,2-dimethylpropyl)-4-methylhexyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione (PubChem CID 20580310) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is 3-[2-(1-hydroperoxy-2,2-dimethylpropyl)-4-methylhexyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione.
| Compound Name | 3-[2-(1-hydroperoxy-2,2-dimethylpropyl)-4-methylhexyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 20580310 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 3-[2-(1-hydroperoxy-2,2-dimethylpropyl)-4-methylhexyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione |
| SMILES | CCC(C)CC(CC1C(=O)OC(=O)C1C(CC)C[Si](C)(C)C)C(OO)C(C)(C)C |
| InChI | InChI=1S/C23H44O5Si/c1-10-15(3)12-17(20(28-26)23(4,5)6)13-18-19(22(25)27-21(18)24)16(11-2)14-29(7,8)9/h15-20,26H,10-14H2,1-9H3 |
| InChIKey | SUAYLSRPNRGNJL-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|