C23H40O7Si — CID 59061036
5-O-tert-butyl 1-O-methyl 2-methyl-4-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate (PubChem CID 59061036) has the molecular formula C23H40O7Si and a molecular weight of 456.65 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-methyl 2-methyl-4-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-methyl 2-methyl-4-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate |
|---|---|
| PubChem CID | 59061036 |
| Molecular Formula | C23H40O7Si |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 5-O-tert-butyl 1-O-methyl 2-methyl-4-[[4-(2-methyl-3-trimethylsilylpropyl)-2,5-dioxooxolan-3-yl]methyl]pentanedioate |
| SMILES | COC(=O)C(C)CC(CC1C(=O)OC(=O)C1CC(C)C[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H40O7Si/c1-14(13-31(7,8)9)10-17-18(22(27)29-21(17)26)12-16(11-15(2)19(24)28-6)20(25)30-23(3,4)5/h14-18H,10-13H2,1-9H3 |
| InChIKey | IUROBWWOVUJAOW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|