C33H64O9Si4 — CID 18684369
4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[(4-methyl-2,5-dioxooxolan-3-yl)methyl]-7-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-7-oxoheptanoic acid (PubChem CID 18684369) has the molecular formula C33H64O9Si4 and a molecular weight of 717.21 g/mol. Its IUPAC name is 4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[(4-methyl-2,5-dioxooxolan-3-yl)methyl]-7-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-7-oxoheptanoic acid.
| Compound Name | 4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[(4-methyl-2,5-dioxooxolan-3-yl)methyl]-7-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 18684369 |
| Molecular Formula | C33H64O9Si4 |
| Molecular Weight | 717.21 g/mol |
| Exact Mass | 716.36 |
| IUPAC Name | 4-methoxycarbonyl-2,4,6,6-tetramethyl-2-[(4-methyl-2,5-dioxooxolan-3-yl)methyl]-7-[2-methyl-4-tris(trimethylsilyl)silylbutan-2-yl]oxy-7-oxoheptanoic acid |
| SMILES | COC(=O)C(C)(CC(C)(C)C(=O)OC(C)(C)CC[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)CC(C)(CC1C(=O)OC(=O)C1C)C(=O)O |
| InChI | InChI=1S/C33H64O9Si4/c1-23-24(26(35)41-25(23)34)20-32(6,27(36)37)22-33(7,29(39)40-8)21-30(2,3)28(38)42-31(4,5)18-19-46(43(9,10)11,44(12,13)14)45(15,16)17/h23-24H,18-22H2,1-17H3,(H,36,37) |
| InChIKey | HGGJXZAQXYFFNL-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.21 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|