C26H46O8Si2 — CID 20822615
[3-[4-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylpropyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate (PubChem CID 20822615) has the molecular formula C26H46O8Si2 and a molecular weight of 542.82 g/mol. Its IUPAC name is [3-[4-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylpropyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate.
| Compound Name | [3-[4-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylpropyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate |
|---|---|
| PubChem CID | 20822615 |
| Molecular Formula | C26H46O8Si2 |
| Molecular Weight | 542.82 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | [3-[4-[2,2-dimethyl-3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-2,5-dioxooxolan-3-yl]-2,2-dimethylpropyl] 2,2,6,6-tetramethyl-1,2,6-oxadisilinane-4-carboxylate |
| SMILES | CC(C)(COC(=O)C1C[Si](C)(C)O[Si](C)(C)C1)CC1C(=O)OC(=O)C1CC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H46O8Si2/c1-24(2,3)33-23(30)26(6,7)13-19-18(21(28)32-22(19)29)12-25(4,5)16-31-20(27)17-14-35(8,9)34-36(10,11)15-17/h17-19H,12-16H2,1-11H3 |
| InChIKey | CATURCWFWQNMOH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.82 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|