C25H44O7Si2 — CID 20754310
1,3-bis(trimethylsilyl)propan-2-yl 3-[4-(2,3-dimethyl-6-oxooxan-2-yl)-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate (PubChem CID 20754310) has the molecular formula C25H44O7Si2 and a molecular weight of 512.79 g/mol. Its IUPAC name is 1,3-bis(trimethylsilyl)propan-2-yl 3-[4-(2,3-dimethyl-6-oxooxan-2-yl)-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate.
| Compound Name | 1,3-bis(trimethylsilyl)propan-2-yl 3-[4-(2,3-dimethyl-6-oxooxan-2-yl)-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 20754310 |
| Molecular Formula | C25H44O7Si2 |
| Molecular Weight | 512.79 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 1,3-bis(trimethylsilyl)propan-2-yl 3-[4-(2,3-dimethyl-6-oxooxan-2-yl)-2,5-dioxooxolan-3-yl]-2,2-dimethylpropanoate |
| SMILES | CC1CCC(=O)OC1(C)C1C(=O)OC(=O)C1CC(C)(C)C(=O)OC(C[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C25H44O7Si2/c1-16-11-12-19(26)32-25(16,4)20-18(21(27)31-22(20)28)13-24(2,3)23(29)30-17(14-33(5,6)7)15-34(8,9)10/h16-18,20H,11-15H2,1-10H3 |
| InChIKey | AHCMGQMXUDIVJW-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.79 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|