C28H46O13Si — CID 20580313
3-[5-[[2,5-dioxo-4-(1-trimethylsilylbutan-2-yl)oxolan-3-yl]methyl]-2,6-dihydroperoxy-3-methyl-6-(4-methyl-2-oxooxan-4-yl)hexoxy]-3-oxopropanoic acid (PubChem CID 20580313) has the molecular formula C28H46O13Si and a molecular weight of 618.75 g/mol. Its IUPAC name is 3-[5-[[2,5-dioxo-4-(1-trimethylsilylbutan-2-yl)oxolan-3-yl]methyl]-2,6-dihydroperoxy-3-methyl-6-(4-methyl-2-oxooxan-4-yl)hexoxy]-3-oxopropanoic acid.
| Compound Name | 3-[5-[[2,5-dioxo-4-(1-trimethylsilylbutan-2-yl)oxolan-3-yl]methyl]-2,6-dihydroperoxy-3-methyl-6-(4-methyl-2-oxooxan-4-yl)hexoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 20580313 |
| Molecular Formula | C28H46O13Si |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 3-[5-[[2,5-dioxo-4-(1-trimethylsilylbutan-2-yl)oxolan-3-yl]methyl]-2,6-dihydroperoxy-3-methyl-6-(4-methyl-2-oxooxan-4-yl)hexoxy]-3-oxopropanoic acid |
| SMILES | CCC(C[Si](C)(C)C)C1C(=O)OC(=O)C1CC(CC(C)C(COC(=O)CC(=O)O)OO)C(OO)C1(C)CCOC(=O)C1 |
| InChI | InChI=1S/C28H46O13Si/c1-7-17(15-42(4,5)6)24-19(26(33)39-27(24)34)11-18(25(41-36)28(3)8-9-37-23(32)13-28)10-16(2)20(40-35)14-38-22(31)12-21(29)30/h16-20,24-25,35-36H,7-15H2,1-6H3,(H,29,30) |
| InChIKey | MVRWRGQIYSORQH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|