C18H32O7Si — CID 59917216
3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-methyloxan-2-yl]-4-methyloxolane-2,5-dione (PubChem CID 59917216) has the molecular formula C18H32O7Si and a molecular weight of 388.53 g/mol. Its IUPAC name is 3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-methyloxan-2-yl]-4-methyloxolane-2,5-dione.
| Compound Name | 3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-methyloxan-2-yl]-4-methyloxolane-2,5-dione |
|---|---|
| PubChem CID | 59917216 |
| Molecular Formula | C18H32O7Si |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-dihydroxy-3-methyloxan-2-yl]-4-methyloxolane-2,5-dione |
| SMILES | CC1C(=O)OC(=O)C1C1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1C |
| InChI | InChI=1S/C18H32O7Si/c1-9-12(17(22)25-16(9)21)15-10(2)13(19)14(20)11(24-15)8-23-26(6,7)18(3,4)5/h9-15,19-20H,8H2,1-7H3 |
| InChIKey | PPOQAVIHDDGOBZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|