C20H36O7 — CID 170990578
(2R,3S)-3-hydroxy-3-[(2S,3S,4S,5R,6S)-3-hydroxy-2,4,6-trimethyl-5-octanoyloxyoxan-2-yl]-2-methylpropanoic acid (PubChem CID 170990578) has the molecular formula C20H36O7 and a molecular weight of 388.50 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-3-[(2S,3S,4S,5R,6S)-3-hydroxy-2,4,6-trimethyl-5-octanoyloxyoxan-2-yl]-2-methylpropanoic acid.
| Compound Name | (2R,3S)-3-hydroxy-3-[(2S,3S,4S,5R,6S)-3-hydroxy-2,4,6-trimethyl-5-octanoyloxyoxan-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 170990578 |
| Molecular Formula | C20H36O7 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (2R,3S)-3-hydroxy-3-[(2S,3S,4S,5R,6S)-3-hydroxy-2,4,6-trimethyl-5-octanoyloxyoxan-2-yl]-2-methylpropanoic acid |
| SMILES | CCCCCCCC(=O)O[C@@H]1[C@@H](C)[C@H](O)[C@@](C)([C@@H](O)[C@@H](C)C(=O)O)O[C@H]1C |
| InChI | InChI=1S/C20H36O7/c1-6-7-8-9-10-11-15(21)26-16-12(2)17(22)20(5,27-14(16)4)18(23)13(3)19(24)25/h12-14,16-18,22-23H,6-11H2,1-5H3,(H,24,25)/t12-,13-,14+,16-,17+,18+,20+/m1/s1 |
| InChIKey | JOYVGTMJUJHOSK-DZEWBDMWSA-N |
| XLogP | 2.51 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|