C30H66O6Si3 — CID 54577710
(2R,3S,5R,6R)-3,6,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethylnonanoic acid (PubChem CID 54577710) has the molecular formula C30H66O6Si3 and a molecular weight of 607.11 g/mol. Its IUPAC name is (2R,3S,5R,6R)-3,6,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethylnonanoic acid.
| Compound Name | (2R,3S,5R,6R)-3,6,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethylnonanoic acid |
|---|---|
| PubChem CID | 54577710 |
| Molecular Formula | C30H66O6Si3 |
| Molecular Weight | 607.11 g/mol |
| Exact Mass | 606.42 |
| IUPAC Name | (2R,3S,5R,6R)-3,6,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5-methoxy-2,6-dimethylnonanoic acid |
| SMILES | CO[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H66O6Si3/c1-23(26(31)32)24(35-38(15,16)28(5,6)7)22-25(33-12)30(11,36-39(17,18)29(8,9)10)20-19-21-34-37(13,14)27(2,3)4/h23-25H,19-22H2,1-18H3,(H,31,32)/t23-,24+,25-,30-/m1/s1 |
| InChIKey | UUWODQVZQPWWIO-FJRSXGRASA-N |
| XLogP | 9.09 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.11 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|