C30H66O6Si3 — CID 54578144
(2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoic acid (PubChem CID 54578144) has the molecular formula C30H66O6Si3 and a molecular weight of 607.11 g/mol. Its IUPAC name is (2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoic acid.
| Compound Name | (2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoic acid |
|---|---|
| PubChem CID | 54578144 |
| Molecular Formula | C30H66O6Si3 |
| Molecular Weight | 607.11 g/mol |
| Exact Mass | 606.42 |
| IUPAC Name | (2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoic acid |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C30H66O6Si3/c1-17-39(18-2,19-3)36-26(23-25(24(4)27(31)32)35-38(15,16)29(8,9)10)30(11,33-12)21-20-22-34-37(13,14)28(5,6)7/h24-26H,17-23H2,1-16H3,(H,31,32)/t24-,25+,26-,30-/m1/s1 |
| InChIKey | LGXUZMQGJHXEOO-YYZJCXNBSA-N |
| XLogP | 9.09 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.11 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|