C35H74O6Si3 — CID 135017575
[(2S,4S,5S,6R,7R,8R)-4,6,8-trimethyl-9-oxo-2,5,7-tris(triethylsilyloxy)nonyl] 2,2-dimethylpropanoate (PubChem CID 135017575) has the molecular formula C35H74O6Si3 and a molecular weight of 675.23 g/mol. Its IUPAC name is [(2S,4S,5S,6R,7R,8R)-4,6,8-trimethyl-9-oxo-2,5,7-tris(triethylsilyloxy)nonyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,4S,5S,6R,7R,8R)-4,6,8-trimethyl-9-oxo-2,5,7-tris(triethylsilyloxy)nonyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 135017575 |
| Molecular Formula | C35H74O6Si3 |
| Molecular Weight | 675.23 g/mol |
| Exact Mass | 674.48 |
| IUPAC Name | [(2S,4S,5S,6R,7R,8R)-4,6,8-trimethyl-9-oxo-2,5,7-tris(triethylsilyloxy)nonyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@H](COC(=O)C(C)(C)C)C[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C=O |
| InChI | InChI=1S/C35H74O6Si3/c1-16-42(17-2,18-3)39-31(27-38-34(37)35(13,14)15)25-28(10)32(40-43(19-4,20-5)21-6)30(12)33(29(11)26-36)41-44(22-7,23-8)24-9/h26,28-33H,16-25,27H2,1-15H3/t28-,29-,30+,31-,32-,33-/m0/s1 |
| InChIKey | ADTSYTUDXLIETM-QXDHOACBSA-N |
| XLogP | 10.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.23 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|