C18H36O5Si — CID 134879224
methyl (2S,3R,4S,5R,6S)-3-methoxy-2,4,6-trimethyl-7-oxo-5-triethylsilyloxyheptanoate (PubChem CID 134879224) has the molecular formula C18H36O5Si and a molecular weight of 360.57 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R,6S)-3-methoxy-2,4,6-trimethyl-7-oxo-5-triethylsilyloxyheptanoate.
| Compound Name | methyl (2S,3R,4S,5R,6S)-3-methoxy-2,4,6-trimethyl-7-oxo-5-triethylsilyloxyheptanoate |
|---|---|
| PubChem CID | 134879224 |
| Molecular Formula | C18H36O5Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | methyl (2S,3R,4S,5R,6S)-3-methoxy-2,4,6-trimethyl-7-oxo-5-triethylsilyloxyheptanoate |
| SMILES | CC[Si](CC)(CC)O[C@H]([C@@H](C)[C@@H](OC)[C@H](C)C(=O)OC)[C@H](C)C=O |
| InChI | InChI=1S/C18H36O5Si/c1-9-24(10-2,11-3)23-16(13(4)12-19)14(5)17(21-7)15(6)18(20)22-8/h12-17H,9-11H2,1-8H3/t13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | GLCWXCVJAOOTPZ-UHDSXZAQSA-N |
| XLogP | 3.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|