C31H68O6Si3 — CID 135043551
(2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoic acid (PubChem CID 135043551) has the molecular formula C31H68O6Si3 and a molecular weight of 621.14 g/mol. Its IUPAC name is (2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoic acid.
| Compound Name | (2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoic acid |
|---|---|
| PubChem CID | 135043551 |
| Molecular Formula | C31H68O6Si3 |
| Molecular Weight | 621.14 g/mol |
| Exact Mass | 620.43 |
| IUPAC Name | (2R,3S,5R,6R,8R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6,8-trimethyl-5-triethylsilyloxynonanoic acid |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O)[C@@](C)(C[C@@H](C)CO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C31H68O6Si3/c1-18-40(19-2,20-3)37-27(21-26(25(5)28(32)33)36-39(16,17)30(9,10)11)31(12,34-13)22-24(4)23-35-38(14,15)29(6,7)8/h24-27H,18-23H2,1-17H3,(H,32,33)/t24-,25-,26+,27-,31-/m1/s1 |
| InChIKey | VCIRNDRGFFWGQE-HBXVOGJASA-N |
| XLogP | 9.33 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.14 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|