C26H58O7Si3 — CID 11028171
(2S,3R,5R,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-11-methoxy-5,7-dimethyl-6,8-bis(trimethylsilyloxy)undecan-4-one (PubChem CID 11028171) has the molecular formula C26H58O7Si3 and a molecular weight of 567.00 g/mol. Its IUPAC name is (2S,3R,5R,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-11-methoxy-5,7-dimethyl-6,8-bis(trimethylsilyloxy)undecan-4-one.
| Compound Name | (2S,3R,5R,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-11-methoxy-5,7-dimethyl-6,8-bis(trimethylsilyloxy)undecan-4-one |
|---|---|
| PubChem CID | 11028171 |
| Molecular Formula | C26H58O7Si3 |
| Molecular Weight | 567.00 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | (2S,3R,5R,6S,7S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-2,3-dihydroxy-11-methoxy-5,7-dimethyl-6,8-bis(trimethylsilyloxy)undecan-4-one |
| SMILES | COC[C@@H](C[C@@H](O[Si](C)(C)C)[C@H](C)[C@H](O[Si](C)(C)C)[C@@H](C)C(=O)[C@H](O)[C@H](C)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H58O7Si3/c1-18(25(33-35(11,12)13)19(2)23(28)24(29)20(3)27)22(32-34(8,9)10)16-21(17-30-7)31-36(14,15)26(4,5)6/h18-22,24-25,27,29H,16-17H2,1-15H3/t18-,19-,20-,21+,22+,24+,25-/m0/s1 |
| InChIKey | VEQXOIPAPWTDDI-YKEKKNTNSA-N |
| XLogP | 5.44 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.00 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|