C30H66O4Si3 — CID 162397163
(2S,3S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5,7-dimethyl-2-triethylsilyl-8-triethylsilyloxydecan-4-one (PubChem CID 162397163) has the molecular formula C30H66O4Si3 and a molecular weight of 575.11 g/mol. Its IUPAC name is (2S,3S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5,7-dimethyl-2-triethylsilyl-8-triethylsilyloxydecan-4-one.
| Compound Name | (2S,3S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5,7-dimethyl-2-triethylsilyl-8-triethylsilyloxydecan-4-one |
|---|---|
| PubChem CID | 162397163 |
| Molecular Formula | C30H66O4Si3 |
| Molecular Weight | 575.11 g/mol |
| Exact Mass | 574.43 |
| IUPAC Name | (2S,3S,8S)-3-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5,7-dimethyl-2-triethylsilyl-8-triethylsilyloxydecan-4-one |
| SMILES | CC[C@H](O[Si](CC)(CC)CC)C(C)C(O)C(C)C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[Si](CC)(CC)CC |
| InChI | InChI=1S/C30H66O4Si3/c1-16-26(33-37(20-5,21-6)22-7)23(8)27(31)24(9)28(32)29(34-35(14,15)30(11,12)13)25(10)36(17-2,18-3)19-4/h23-27,29,31H,16-22H2,1-15H3/t23?,24?,25-,26-,27?,29+/m0/s1 |
| InChIKey | JGEYQLAIXFQGSP-BNUMHPNLSA-N |
| XLogP | 9.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.11 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|