C17H36O3Si — CID 134835604
(3S,6S)-3-hydroxy-2,8-dimethyl-6-triethylsilyloxynonan-5-one (PubChem CID 134835604) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is (3S,6S)-3-hydroxy-2,8-dimethyl-6-triethylsilyloxynonan-5-one.
| Compound Name | (3S,6S)-3-hydroxy-2,8-dimethyl-6-triethylsilyloxynonan-5-one |
|---|---|
| PubChem CID | 134835604 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (3S,6S)-3-hydroxy-2,8-dimethyl-6-triethylsilyloxynonan-5-one |
| SMILES | CC[Si](CC)(CC)O[C@@H](CC(C)C)C(=O)C[C@H](O)C(C)C |
| InChI | InChI=1S/C17H36O3Si/c1-8-21(9-2,10-3)20-17(11-13(4)5)16(19)12-15(18)14(6)7/h13-15,17-18H,8-12H2,1-7H3/t15-,17-/m0/s1 |
| InChIKey | MEMOIDVMFDJGJZ-RDJZCZTQSA-N |
| XLogP | 4.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|