C26H52O6Si2 — CID 132553530
(3R,4S,5S,6S)-6-[(2S,4R,5R,6R,7R)-4,6-dimethyl-3-oxo-7-triethylsilyloxy-5-trimethylsilyloxyoctan-2-yl]-4-hydroxy-3,5-dimethyloxan-2-one (PubChem CID 132553530) has the molecular formula C26H52O6Si2 and a molecular weight of 516.87 g/mol. Its IUPAC name is (3R,4S,5S,6S)-6-[(2S,4R,5R,6R,7R)-4,6-dimethyl-3-oxo-7-triethylsilyloxy-5-trimethylsilyloxyoctan-2-yl]-4-hydroxy-3,5-dimethyloxan-2-one.
| Compound Name | (3R,4S,5S,6S)-6-[(2S,4R,5R,6R,7R)-4,6-dimethyl-3-oxo-7-triethylsilyloxy-5-trimethylsilyloxyoctan-2-yl]-4-hydroxy-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 132553530 |
| Molecular Formula | C26H52O6Si2 |
| Molecular Weight | 516.87 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | (3R,4S,5S,6S)-6-[(2S,4R,5R,6R,7R)-4,6-dimethyl-3-oxo-7-triethylsilyloxy-5-trimethylsilyloxyoctan-2-yl]-4-hydroxy-3,5-dimethyloxan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H](C)[C@@H](C)[C@@H](O[Si](C)(C)C)[C@@H](C)C(=O)[C@@H](C)[C@H]1OC(=O)[C@H](C)[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C26H52O6Si2/c1-13-34(14-2,15-3)31-21(9)16(4)25(32-33(10,11)12)19(7)22(27)17(5)24-18(6)23(28)20(8)26(29)30-24/h16-21,23-25,28H,13-15H2,1-12H3/t16-,17-,18+,19+,20-,21-,23+,24-,25-/m1/s1 |
| InChIKey | DTHCNSFCISRQMF-DPLHBHFDSA-N |
| XLogP | 5.65 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.87 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|