C22H44O5Si — CID 134929617
methyl (2R,3S,4S,6S,10S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,10-tetramethyl-7-oxoundecanoate (PubChem CID 134929617) has the molecular formula C22H44O5Si and a molecular weight of 416.68 g/mol. Its IUPAC name is methyl (2R,3S,4S,6S,10S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,10-tetramethyl-7-oxoundecanoate.
| Compound Name | methyl (2R,3S,4S,6S,10S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,10-tetramethyl-7-oxoundecanoate |
|---|---|
| PubChem CID | 134929617 |
| Molecular Formula | C22H44O5Si |
| Molecular Weight | 416.68 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | methyl (2R,3S,4S,6S,10S)-11-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4,6,10-tetramethyl-7-oxoundecanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](O)[C@@H](C)C[C@H](C)C(=O)CC[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O5Si/c1-15(14-27-28(9,10)22(5,6)7)11-12-19(23)16(2)13-17(3)20(24)18(4)21(25)26-8/h15-18,20,24H,11-14H2,1-10H3/t15-,16-,17-,18+,20-/m0/s1 |
| InChIKey | LQDOVUJVCYORDV-CBNQQXHVSA-N |
| XLogP | 4.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.68 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|