C27H50O8Si — CID 134841387
(1R,3S,5R,7R,18S)-7-[tert-butyl(dimethyl)silyl]oxy-13-[(1R)-1,2-dihydroxyethyl]-3-methoxy-18-methyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 134841387) has the molecular formula C27H50O8Si and a molecular weight of 530.78 g/mol. Its IUPAC name is (1R,3S,5R,7R,18S)-7-[tert-butyl(dimethyl)silyl]oxy-13-[(1R)-1,2-dihydroxyethyl]-3-methoxy-18-methyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1R,3S,5R,7R,18S)-7-[tert-butyl(dimethyl)silyl]oxy-13-[(1R)-1,2-dihydroxyethyl]-3-methoxy-18-methyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 134841387 |
| Molecular Formula | C27H50O8Si |
| Molecular Weight | 530.78 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | (1R,3S,5R,7R,18S)-7-[tert-butyl(dimethyl)silyl]oxy-13-[(1R)-1,2-dihydroxyethyl]-3-methoxy-18-methyl-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | CO[C@H]1C[C@@H]2C[C@@H](O[Si](C)(C)C(C)(C)C)CC(CC(=O)OC([C@H](O)CO)CC3CC[C@H](C)[C@@H](C1)O3)O2 |
| InChI | InChI=1S/C27H50O8Si/c1-17-8-9-18-13-25(23(29)16-28)34-26(30)15-21-12-22(35-36(6,7)27(2,3)4)11-20(32-21)10-19(31-5)14-24(17)33-18/h17-25,28-29H,8-16H2,1-7H3/t17-,18?,19-,20+,21?,22+,23+,24+,25?/m0/s1 |
| InChIKey | RRUICSSKYDDQKP-ZUYNMZCRSA-N |
| XLogP | 3.96 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|