C22H42O6Si — CID 135013981
tert-butyl (2R,5S,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-2,7-dihydroxy-2,6-dimethyl-10-oxabicyclo[5.2.1]decane-8-carboxylate (PubChem CID 135013981) has the molecular formula C22H42O6Si and a molecular weight of 430.66 g/mol. Its IUPAC name is tert-butyl (2R,5S,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-2,7-dihydroxy-2,6-dimethyl-10-oxabicyclo[5.2.1]decane-8-carboxylate.
| Compound Name | tert-butyl (2R,5S,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-2,7-dihydroxy-2,6-dimethyl-10-oxabicyclo[5.2.1]decane-8-carboxylate |
|---|---|
| PubChem CID | 135013981 |
| Molecular Formula | C22H42O6Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | tert-butyl (2R,5S,7S,8S)-5-[tert-butyl(dimethyl)silyl]oxy-2,7-dihydroxy-2,6-dimethyl-10-oxabicyclo[5.2.1]decane-8-carboxylate |
| SMILES | CC1[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@](C)(O)C2C[C@H](C(=O)OC(C)(C)C)[C@@]1(O)O2 |
| InChI | InChI=1S/C22H42O6Si/c1-14-16(28-29(9,10)20(5,6)7)11-12-21(8,24)17-13-15(22(14,25)26-17)18(23)27-19(2,3)4/h14-17,24-25H,11-13H2,1-10H3/t14?,15-,16+,17?,21-,22+/m1/s1 |
| InChIKey | LNPAGOYHFWTFQH-QMGSNWTPSA-N |
| XLogP | 3.99 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|