C30H50O11Si — CID 20580315
3-[5-(5,5-dimethyl-2-oxooxolan-3-yl)-5-hydroperoxy-2-[hydroperoxy-(4-methyl-2-oxooxan-4-yl)methyl]-4-methylpentyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione (PubChem CID 20580315) has the molecular formula C30H50O11Si and a molecular weight of 614.81 g/mol. Its IUPAC name is 3-[5-(5,5-dimethyl-2-oxooxolan-3-yl)-5-hydroperoxy-2-[hydroperoxy-(4-methyl-2-oxooxan-4-yl)methyl]-4-methylpentyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione.
| Compound Name | 3-[5-(5,5-dimethyl-2-oxooxolan-3-yl)-5-hydroperoxy-2-[hydroperoxy-(4-methyl-2-oxooxan-4-yl)methyl]-4-methylpentyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 20580315 |
| Molecular Formula | C30H50O11Si |
| Molecular Weight | 614.81 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | 3-[5-(5,5-dimethyl-2-oxooxolan-3-yl)-5-hydroperoxy-2-[hydroperoxy-(4-methyl-2-oxooxan-4-yl)methyl]-4-methylpentyl]-4-(1-trimethylsilylbutan-2-yl)oxolane-2,5-dione |
| SMILES | CCC(C[Si](C)(C)C)C1C(=O)OC(=O)C1CC(CC(C)C(OO)C1CC(C)(C)OC1=O)C(OO)C1(C)CCOC(=O)C1 |
| InChI | InChI=1S/C30H50O11Si/c1-9-18(16-42(6,7)8)23-20(26(32)38-28(23)34)13-19(25(41-36)30(5)10-11-37-22(31)15-30)12-17(2)24(40-35)21-14-29(3,4)39-27(21)33/h17-21,23-25,35-36H,9-16H2,1-8H3 |
| InChIKey | RSPPCOALKLSGKZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 154.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.81 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|